C12H10ClN3O — CID 67168307
4-[5-(2-aminoethyl)-1,2-oxazol-3-yl]-2-chlorobenzonitrile (PubChem CID 67168307) has the molecular formula C12H10ClN3O and a molecular weight of 247.69 g/mol. Its IUPAC name is 4-[5-(2-aminoethyl)-1,2-oxazol-3-yl]-2-chlorobenzonitrile.
| Compound Name | 4-[5-(2-aminoethyl)-1,2-oxazol-3-yl]-2-chlorobenzonitrile |
|---|---|
| PubChem CID | 67168307 |
| Molecular Formula | C12H10ClN3O |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 4-[5-(2-aminoethyl)-1,2-oxazol-3-yl]-2-chlorobenzonitrile |
| SMILES | N#Cc1ccc(-c2cc(CCN)on2)cc1Cl |
| InChI | InChI=1S/C12H10ClN3O/c13-11-5-8(1-2-9(11)7-15)12-6-10(3-4-14)17-16-12/h1-2,5-6H,3-4,14H2 |
| InChIKey | MLNAYEQFFAYIHQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |