C9H6Cl2N2O2 — CID 2726656
[5-(3,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]methanol (PubChem CID 2726656) has the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. Its IUPAC name is [5-(3,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]methanol.
| Compound Name | [5-(3,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]methanol |
|---|---|
| PubChem CID | 2726656 |
| Molecular Formula | C9H6Cl2N2O2 |
| Molecular Weight | 245.06 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | [5-(3,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]methanol |
| SMILES | OCc1noc(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C9H6Cl2N2O2/c10-6-2-1-5(3-7(6)11)9-12-8(4-14)13-15-9/h1-3,14H,4H2 |
| InChIKey | SHVXQHKUAJGNBL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.06 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |