C13H13PS — CID 143072743
4-(4-methylphosphanylphenyl)benzenethiol (PubChem CID 143072743) has the molecular formula C13H13PS and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-(4-methylphosphanylphenyl)benzenethiol.
| Compound Name | 4-(4-methylphosphanylphenyl)benzenethiol |
|---|---|
| PubChem CID | 143072743 |
| Molecular Formula | C13H13PS |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 4-(4-methylphosphanylphenyl)benzenethiol |
| SMILES | CPc1ccc(-c2ccc(S)cc2)cc1 |
| InChI | InChI=1S/C13H13PS/c1-14-12-6-2-10(3-7-12)11-4-8-13(15)9-5-11/h2-9,14-15H,1H3 |
| InChIKey | KOCVVYQUSCJPQK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|