About gold(1+);4-sulfanylphenol
gold(1+);4-sulfanylphenol (PubChem CID 19367562) has the molecular formula C6H6AuOS+
and a molecular weight of 323.15 g/mol. Its IUPAC name is gold(1+);4-sulfanylphenol.
Molecular Properties
| Compound Name | gold(1+);4-sulfanylphenol |
| PubChem CID | 19367562 |
| Molecular Formula | C6H6AuOS+ |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | gold(1+);4-sulfanylphenol |
| SMILES | Oc1ccc(S)cc1.[Au+] |
| InChI | InChI=1S/C6H6OS.Au/c7-5-1-3-6(8)4-2-5;/h1-4,7-8H;/q;+1 |
| InChIKey | LJSZIWIXJWWDAW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);4-sulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);4-sulfanylphenol?
The IUPAC name of gold(1+);4-sulfanylphenol (CID 19367562) is gold(1+);4-sulfanylphenol.
What is the SMILES notation for gold(1+);4-sulfanylphenol?
The canonical SMILES for gold(1+);4-sulfanylphenol is Oc1ccc(S)cc1.[Au+].
What is the InChIKey of gold(1+);4-sulfanylphenol?
The InChIKey is LJSZIWIXJWWDAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6OS.Au/c7-5-1-3-6(8)4-2-5;/h1-4,7-8H;/q;+1.
What are the key properties of gold(1+);4-sulfanylphenol?
gold(1+);4-sulfanylphenol has a molecular weight of 323.15 g/mol, XLogP of 1.68, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);4-sulfanylphenol is sourced from PubChem (CID 19367562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).