C12H20 — CID 142364149
2,3-diethyl-1,4-dimethylcyclohexa-1,3-diene (PubChem CID 142364149) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 2,3-diethyl-1,4-dimethylcyclohexa-1,3-diene.
| Compound Name | 2,3-diethyl-1,4-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142364149 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 2,3-diethyl-1,4-dimethylcyclohexa-1,3-diene |
| SMILES | CCC1=C(C)CCC(C)=C1CC |
| InChI | InChI=1S/C12H20/c1-5-11-9(3)7-8-10(4)12(11)6-2/h5-8H2,1-4H3 |
| InChIKey | KZOBTJLQAAVKLB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |