C36H100 — CID 158813284
3,6-diethyl-2,5-dimethyl-1,4-dihydropentalene;ethane;methane (PubChem CID 158813284) has the molecular formula C36H100 and a molecular weight of 533.20 g/mol. Its IUPAC name is 3,6-diethyl-2,5-dimethyl-1,4-dihydropentalene;ethane;methane.
| Compound Name | 3,6-diethyl-2,5-dimethyl-1,4-dihydropentalene;ethane;methane |
|---|---|
| PubChem CID | 158813284 |
| Molecular Formula | C36H100 |
| Molecular Weight | 533.20 g/mol |
| Exact Mass | 532.78 |
| IUPAC Name | 3,6-diethyl-2,5-dimethyl-1,4-dihydropentalene;ethane;methane |
| SMILES | C.C.C.C.C.C.C.C.C.C.C.C.C.C.CC.CC.CC.CC.CCC1=C(C)CC2=C1CC(C)=C2CC |
| InChI | InChI=1S/C14H20.4C2H6.14CH4/c1-5-11-9(3)7-14-12(6-2)10(4)8-13(11)14;4*1-2;;;;;;;;;;;;;;/h5-8H2,1-4H3;4*1-2H3;14*1H4 |
| InChIKey | IUYJPQUXBNQNTH-UHFFFAOYSA-N |
| XLogP | 17.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.20 |
| LogP ≤ 5 | 17.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |