C7H8O3 — CID 12729186
4-ethyl-5-hydroxycyclopent-4-ene-1,3-dione (PubChem CID 12729186) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is 4-ethyl-5-hydroxycyclopent-4-ene-1,3-dione.
| Compound Name | 4-ethyl-5-hydroxycyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 12729186 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 4-ethyl-5-hydroxycyclopent-4-ene-1,3-dione |
| SMILES | CCC1=C(O)C(=O)CC1=O |
| InChI | InChI=1S/C7H8O3/c1-2-4-5(8)3-6(9)7(4)10/h10H,2-3H2,1H3 |
| InChIKey | VBIJPNQOJBRJID-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|