C8H10O — CID 123602954
4-ethyl-2-methylcyclopenta-2,3-dien-1-one (PubChem CID 123602954) has the molecular formula C8H10O and a molecular weight of 122.17 g/mol. Its IUPAC name is 4-ethyl-2-methylcyclopenta-2,3-dien-1-one.
| Compound Name | 4-ethyl-2-methylcyclopenta-2,3-dien-1-one |
|---|---|
| PubChem CID | 123602954 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 4-ethyl-2-methylcyclopenta-2,3-dien-1-one |
| SMILES | CCC1=C=C(C)C(=O)C1 |
| InChI | InChI=1S/C8H10O/c1-3-7-4-6(2)8(9)5-7/h3,5H2,1-2H3 |
| InChIKey | VXRWZINRDVVAPF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |