C7H11NO2 — CID 86318642
(5R)-5-ethylpiperidine-2,4-dione (PubChem CID 86318642) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (5R)-5-ethylpiperidine-2,4-dione.
| Compound Name | (5R)-5-ethylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 86318642 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (5R)-5-ethylpiperidine-2,4-dione |
| SMILES | CC[C@@H]1CNC(=O)CC1=O |
| InChI | InChI=1S/C7H11NO2/c1-2-5-4-8-7(10)3-6(5)9/h5H,2-4H2,1H3,(H,8,10)/t5-/m1/s1 |
| InChIKey | BIPNFYPMYSWIGH-RXMQYKEDSA-N |
| XLogP | 0.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|