C9H20N2O — CID 167517882
ethane;6-ethyl-1,4-diazepan-5-one (PubChem CID 167517882) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is ethane;6-ethyl-1,4-diazepan-5-one.
| Compound Name | ethane;6-ethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 167517882 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | ethane;6-ethyl-1,4-diazepan-5-one |
| SMILES | CC.CCC1CNCCNC1=O |
| InChI | InChI=1S/C7H14N2O.C2H6/c1-2-6-5-8-3-4-9-7(6)10;1-2/h6,8H,2-5H2,1H3,(H,9,10);1-2H3 |
| InChIKey | VDTWOVIAYSFUBN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |