About 3-ethylazepan-2-one;7-ethylazepan-2-one
3-ethylazepan-2-one;7-ethylazepan-2-one (PubChem CID 161134741) has the molecular formula C16H30N2O2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-ethylazepan-2-one;7-ethylazepan-2-one.
Molecular Properties
| Compound Name | 3-ethylazepan-2-one;7-ethylazepan-2-one |
| PubChem CID | 161134741 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 3-ethylazepan-2-one;7-ethylazepan-2-one |
| SMILES | CCC1CCCCC(=O)N1.CCC1CCCCNC1=O |
| InChI | InChI=1S/2C8H15NO/c1-2-7-5-3-4-6-9-8(7)10;1-2-7-5-3-4-6-8(10)9-7/h2*7H,2-6H2,1H3,(H,9,10) |
| InChIKey | UMQJVWGENJKDLO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethylazepan-2-one;7-ethylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylazepan-2-one;7-ethylazepan-2-one?
The IUPAC name of 3-ethylazepan-2-one;7-ethylazepan-2-one (CID 161134741) is 3-ethylazepan-2-one;7-ethylazepan-2-one.
What is the SMILES notation for 3-ethylazepan-2-one;7-ethylazepan-2-one?
The canonical SMILES for 3-ethylazepan-2-one;7-ethylazepan-2-one is CCC1CCCCC(=O)N1.CCC1CCCCNC1=O.
What is the InChIKey of 3-ethylazepan-2-one;7-ethylazepan-2-one?
The InChIKey is UMQJVWGENJKDLO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H15NO/c1-2-7-5-3-4-6-9-8(7)10;1-2-7-5-3-4-6-8(10)9-7/h2*7H,2-6H2,1H3,(H,9,10).
What are the key properties of 3-ethylazepan-2-one;7-ethylazepan-2-one?
3-ethylazepan-2-one;7-ethylazepan-2-one has a molecular weight of 282.43 g/mol, XLogP of 2.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylazepan-2-one;7-ethylazepan-2-one is sourced from PubChem (CID 161134741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).