C22H38N2O6 — CID 10387757
3,14-diethyl-1,12-dioxa-4,15-diazacyclodocosane-5,11,16,22-tetrone (PubChem CID 10387757) has the molecular formula C22H38N2O6 and a molecular weight of 426.55 g/mol. Its IUPAC name is 3,14-diethyl-1,12-dioxa-4,15-diazacyclodocosane-5,11,16,22-tetrone.
| Compound Name | 3,14-diethyl-1,12-dioxa-4,15-diazacyclodocosane-5,11,16,22-tetrone |
|---|---|
| PubChem CID | 10387757 |
| Molecular Formula | C22H38N2O6 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 3,14-diethyl-1,12-dioxa-4,15-diazacyclodocosane-5,11,16,22-tetrone |
| SMILES | CCC1COC(=O)CCCCCC(=O)NC(CC)COC(=O)CCCCCC(=O)N1 |
| InChI | InChI=1S/C22H38N2O6/c1-3-17-15-29-21(27)13-9-6-8-12-20(26)24-18(4-2)16-30-22(28)14-10-5-7-11-19(25)23-17/h17-18H,3-16H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | GFFSHYCHVDRLIE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |