C14H24F2O2 — CID 132556996
(13R)-9,9-difluoro-13-methyl-oxacyclotetradecan-2-one (PubChem CID 132556996) has the molecular formula C14H24F2O2 and a molecular weight of 262.34 g/mol. Its IUPAC name is (13R)-9,9-difluoro-13-methyl-oxacyclotetradecan-2-one.
| Compound Name | (13R)-9,9-difluoro-13-methyl-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 132556996 |
| Molecular Formula | C14H24F2O2 |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (13R)-9,9-difluoro-13-methyl-oxacyclotetradecan-2-one |
| SMILES | C[C@@H]1CCCC(F)(F)CCCCCCC(=O)OC1 |
| InChI | InChI=1S/C14H24F2O2/c1-12-7-6-10-14(15,16)9-5-3-2-4-8-13(17)18-11-12/h12H,2-11H2,1H3/t12-/m1/s1 |
| InChIKey | RGYPPBNSXQWVOS-GFCCVEGCSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |