C16H26F2O — CID 132579201
(3R,6Z)-10,10-difluoro-3-methylcyclopentadec-6-en-1-one (PubChem CID 132579201) has the molecular formula C16H26F2O and a molecular weight of 272.38 g/mol. Its IUPAC name is (3R,6Z)-10,10-difluoro-3-methylcyclopentadec-6-en-1-one.
| Compound Name | (3R,6Z)-10,10-difluoro-3-methylcyclopentadec-6-en-1-one |
|---|---|
| PubChem CID | 132579201 |
| Molecular Formula | C16H26F2O |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (3R,6Z)-10,10-difluoro-3-methylcyclopentadec-6-en-1-one |
| SMILES | C[C@@H]1CC/C=C\CCC(F)(F)CCCCCC(=O)C1 |
| InChI | InChI=1S/C16H26F2O/c1-14-9-5-2-3-7-11-16(17,18)12-8-4-6-10-15(19)13-14/h2-3,14H,4-13H2,1H3/b3-2-/t14-/m1/s1 |
| InChIKey | WGDPOTDLYWPQFY-PYLYLYNFSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|