About methane;5-methyloxan-2-one;4-methyloxolan-2-one
methane;5-methyloxan-2-one;4-methyloxolan-2-one (PubChem CID 160997869) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is methane;5-methyloxan-2-one;4-methyloxolan-2-one.
Molecular Properties
| Compound Name | methane;5-methyloxan-2-one;4-methyloxolan-2-one |
| PubChem CID | 160997869 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | methane;5-methyloxan-2-one;4-methyloxolan-2-one |
| SMILES | C.CC1CCC(=O)OC1.CC1COC(=O)C1 |
| InChI | InChI=1S/C6H10O2.C5H8O2.CH4/c1-5-2-3-6(7)8-4-5;1-4-2-5(6)7-3-4;/h5H,2-4H2,1H3;4H,2-3H2,1H3;1H4 |
| InChIKey | TVMGBPZXDAQKGW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;5-methyloxan-2-one;4-methyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-methyloxan-2-one;4-methyloxolan-2-one?
The IUPAC name of methane;5-methyloxan-2-one;4-methyloxolan-2-one (CID 160997869) is methane;5-methyloxan-2-one;4-methyloxolan-2-one.
What is the SMILES notation for methane;5-methyloxan-2-one;4-methyloxolan-2-one?
The canonical SMILES for methane;5-methyloxan-2-one;4-methyloxolan-2-one is C.CC1CCC(=O)OC1.CC1COC(=O)C1.
What is the InChIKey of methane;5-methyloxan-2-one;4-methyloxolan-2-one?
The InChIKey is TVMGBPZXDAQKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C5H8O2.CH4/c1-5-2-3-6(7)8-4-5;1-4-2-5(6)7-3-4;/h5H,2-4H2,1H3;4H,2-3H2,1H3;1H4.
What are the key properties of methane;5-methyloxan-2-one;4-methyloxolan-2-one?
methane;5-methyloxan-2-one;4-methyloxolan-2-one has a molecular weight of 230.30 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-methyloxan-2-one;4-methyloxolan-2-one is sourced from PubChem (CID 160997869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).