About ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one
ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one (PubChem CID 142211982) has the molecular formula C24H42O8
and a molecular weight of 458.59 g/mol. Its IUPAC name is ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one.
Molecular Properties
| Compound Name | ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one |
| PubChem CID | 142211982 |
| Molecular Formula | C24H42O8 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one |
| SMILES | CC.CC1CCC(=O)O1.CC1COC(=O)C1.CCC1CCC(=O)OC1.O=C1CCCCO1 |
| InChI | InChI=1S/C7H12O2.3C5H8O2.C2H6/c1-2-6-3-4-7(8)9-5-6;1-4-2-5(6)7-3-4;1-4-2-3-5(6)7-4;6-5-3-1-2-4-7-5;1-2/h6H,2-5H2,1H3;2*4H,2-3H2,1H3;1-4H2;1-2H3 |
| InChIKey | YMQXWZORECHDDF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one?
The IUPAC name of ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one (CID 142211982) is ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one.
What is the SMILES notation for ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one?
The canonical SMILES for ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one is CC.CC1CCC(=O)O1.CC1COC(=O)C1.CCC1CCC(=O)OC1.O=C1CCCCO1.
What is the InChIKey of ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one?
The InChIKey is YMQXWZORECHDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.3C5H8O2.C2H6/c1-2-6-3-4-7(8)9-5-6;1-4-2-5(6)7-3-4;1-4-2-3-5(6)7-4;6-5-3-1-2-4-7-5;1-2/h6H,2-5H2,1H3;2*4H,2-3H2,1H3;1-4H2;1-2H3.
What are the key properties of ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one?
ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one has a molecular weight of 458.59 g/mol, XLogP of 4.37, 1 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyloxan-2-one;4-methyloxolan-2-one;5-methyloxolan-2-one;oxan-2-one is sourced from PubChem (CID 142211982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).