C15H26O4 — CID 154427465
2,5-diethyl-1,7-dioxacyclotridecane-8,13-dione (PubChem CID 154427465) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2,5-diethyl-1,7-dioxacyclotridecane-8,13-dione.
| Compound Name | 2,5-diethyl-1,7-dioxacyclotridecane-8,13-dione |
|---|---|
| PubChem CID | 154427465 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2,5-diethyl-1,7-dioxacyclotridecane-8,13-dione |
| SMILES | CCC1CCC(CC)OC(=O)CCCCC(=O)OC1 |
| InChI | InChI=1S/C15H26O4/c1-3-12-9-10-13(4-2)19-15(17)8-6-5-7-14(16)18-11-12/h12-13H,3-11H2,1-2H3 |
| InChIKey | DMTMCSXSLHNXHZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |