About 6-ethyloxan-2-one;oxan-2-ol
6-ethyloxan-2-one;oxan-2-ol (PubChem CID 144771613) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 6-ethyloxan-2-one;oxan-2-ol.
Molecular Properties
| Compound Name | 6-ethyloxan-2-one;oxan-2-ol |
| PubChem CID | 144771613 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 6-ethyloxan-2-one;oxan-2-ol |
| SMILES | CCC1CCCC(=O)O1.OC1CCCCO1 |
| InChI | InChI=1S/C7H12O2.C5H10O2/c1-2-6-4-3-5-7(8)9-6;6-5-3-1-2-4-7-5/h6H,2-5H2,1H3;5-6H,1-4H2 |
| InChIKey | HPZFFPJHBGHGBY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-ethyloxan-2-one;oxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyloxan-2-one;oxan-2-ol?
The IUPAC name of 6-ethyloxan-2-one;oxan-2-ol (CID 144771613) is 6-ethyloxan-2-one;oxan-2-ol.
What is the SMILES notation for 6-ethyloxan-2-one;oxan-2-ol?
The canonical SMILES for 6-ethyloxan-2-one;oxan-2-ol is CCC1CCCC(=O)O1.OC1CCCCO1.
What is the InChIKey of 6-ethyloxan-2-one;oxan-2-ol?
The InChIKey is HPZFFPJHBGHGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C5H10O2/c1-2-6-4-3-5-7(8)9-6;6-5-3-1-2-4-7-5/h6H,2-5H2,1H3;5-6H,1-4H2.
What are the key properties of 6-ethyloxan-2-one;oxan-2-ol?
6-ethyloxan-2-one;oxan-2-ol has a molecular weight of 230.30 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyloxan-2-one;oxan-2-ol is sourced from PubChem (CID 144771613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).