C10H18O2 — CID 45096478
(4R,6S)-4-methyl-6-propan-2-yloxepan-2-one (PubChem CID 45096478) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (4R,6S)-4-methyl-6-propan-2-yloxepan-2-one.
| Compound Name | (4R,6S)-4-methyl-6-propan-2-yloxepan-2-one |
|---|---|
| PubChem CID | 45096478 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (4R,6S)-4-methyl-6-propan-2-yloxepan-2-one |
| SMILES | CC(C)[C@H]1COC(=O)C[C@H](C)C1 |
| InChI | InChI=1S/C10H18O2/c1-7(2)9-4-8(3)5-10(11)12-6-9/h7-9H,4-6H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | VGGSOYJCWAZJSX-RKDXNWHRSA-N |
| XLogP | 2.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |