About (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one)
(3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one) (PubChem CID 159892024) has the molecular formula C15H26O7
and a molecular weight of 318.37 g/mol. Its IUPAC name is (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one).
Molecular Properties
| Compound Name | (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one) |
| PubChem CID | 159892024 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one) |
| SMILES | C[C@@H]1COC(=O)C1.C[C@@H]1COC(=O)C1.C[C@H](CO)CC(=O)O |
| InChI | InChI=1S/C5H10O3.2C5H8O2/c1-4(3-6)2-5(7)8;2*1-4-2-5(6)7-3-4/h4,6H,2-3H2,1H3,(H,7,8);2*4H,2-3H2,1H3/t3*4-/m000/s1 |
| InChIKey | NUWILWDCUAZZBC-MOBQZEGBSA-N |
| XLogP | 1.23 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one)?
The IUPAC name of (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one) (CID 159892024) is (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one).
What is the SMILES notation for (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one)?
The canonical SMILES for (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one) is C[C@@H]1COC(=O)C1.C[C@@H]1COC(=O)C1.C[C@H](CO)CC(=O)O.
What is the InChIKey of (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one)?
The InChIKey is NUWILWDCUAZZBC-MOBQZEGBSA-N. The full InChI is InChI=1S/C5H10O3.2C5H8O2/c1-4(3-6)2-5(7)8;2*1-4-2-5(6)7-3-4/h4,6H,2-3H2,1H3,(H,7,8);2*4H,2-3H2,1H3/t3*4-/m000/s1.
What are the key properties of (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one)?
(3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one) has a molecular weight of 318.37 g/mol, XLogP of 1.23, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-hydroxy-3-methylbutanoic acid;bis((4S)-4-methyloxolan-2-one) is sourced from PubChem (CID 159892024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).