C12H20O4 — CID 142966420
4,4-dimethyloxan-2-one;4-methyloxolan-2-one (PubChem CID 142966420) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4,4-dimethyloxan-2-one;4-methyloxolan-2-one.
| Compound Name | 4,4-dimethyloxan-2-one;4-methyloxolan-2-one |
|---|---|
| PubChem CID | 142966420 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4,4-dimethyloxan-2-one;4-methyloxolan-2-one |
| SMILES | CC1(C)CCOC(=O)C1.CC1COC(=O)C1 |
| InChI | InChI=1S/C7H12O2.C5H8O2/c1-7(2)3-4-9-6(8)5-7;1-4-2-5(6)7-3-4/h3-5H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | XHXXKKDWHBYSRG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |