About methyl (2-oxoazepan-3-yl)methyl carbonate
methyl (2-oxoazepan-3-yl)methyl carbonate (PubChem CID 139614843) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is methyl (2-oxoazepan-3-yl)methyl carbonate.
Molecular Properties
| Compound Name | methyl (2-oxoazepan-3-yl)methyl carbonate |
| PubChem CID | 139614843 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | methyl (2-oxoazepan-3-yl)methyl carbonate |
| SMILES | COC(=O)OCC1CCCCNC1=O |
| InChI | InChI=1S/C9H15NO4/c1-13-9(12)14-6-7-4-2-3-5-10-8(7)11/h7H,2-6H2,1H3,(H,10,11) |
| InChIKey | UQDWAHDUZICDNM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2-oxoazepan-3-yl)methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2-oxoazepan-3-yl)methyl carbonate?
The IUPAC name of methyl (2-oxoazepan-3-yl)methyl carbonate (CID 139614843) is methyl (2-oxoazepan-3-yl)methyl carbonate.
What is the SMILES notation for methyl (2-oxoazepan-3-yl)methyl carbonate?
The canonical SMILES for methyl (2-oxoazepan-3-yl)methyl carbonate is COC(=O)OCC1CCCCNC1=O.
What is the InChIKey of methyl (2-oxoazepan-3-yl)methyl carbonate?
The InChIKey is UQDWAHDUZICDNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c1-13-9(12)14-6-7-4-2-3-5-10-8(7)11/h7H,2-6H2,1H3,(H,10,11).
What are the key properties of methyl (2-oxoazepan-3-yl)methyl carbonate?
methyl (2-oxoazepan-3-yl)methyl carbonate has a molecular weight of 201.22 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2-oxoazepan-3-yl)methyl carbonate is sourced from PubChem (CID 139614843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).