C11H15NO5 — CID 129058726
1-O-ethyl 4-O-[[(3S)-2-oxopyrrolidin-3-yl]methyl] (E)-but-2-enedioate (PubChem CID 129058726) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[[(3S)-2-oxopyrrolidin-3-yl]methyl] (E)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-[[(3S)-2-oxopyrrolidin-3-yl]methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 129058726 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 1-O-ethyl 4-O-[[(3S)-2-oxopyrrolidin-3-yl]methyl] (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OC[C@@H]1CCNC1=O |
| InChI | InChI=1S/C11H15NO5/c1-2-16-9(13)3-4-10(14)17-7-8-5-6-12-11(8)15/h3-4,8H,2,5-7H2,1H3,(H,12,15)/b4-3+/t8-/m0/s1 |
| InChIKey | ZVMGIWDVJJXCEI-RTMURIBGSA-N |
| XLogP | -0.22 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|