C12H17NO5 — CID 122482350
4-O-(4,4-dimethyl-2-oxopyrrolidin-3-yl) 1-O-ethyl (E)-but-2-enedioate (PubChem CID 122482350) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-O-(4,4-dimethyl-2-oxopyrrolidin-3-yl) 1-O-ethyl (E)-but-2-enedioate.
| Compound Name | 4-O-(4,4-dimethyl-2-oxopyrrolidin-3-yl) 1-O-ethyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122482350 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-O-(4,4-dimethyl-2-oxopyrrolidin-3-yl) 1-O-ethyl (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OC1C(=O)NCC1(C)C |
| InChI | InChI=1S/C12H17NO5/c1-4-17-8(14)5-6-9(15)18-10-11(16)13-7-12(10,2)3/h5-6,10H,4,7H2,1-3H3,(H,13,16)/b6-5+ |
| InChIKey | YFYQNBSCGCMRTG-AATRIKPKSA-N |
| XLogP | 0.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|