C17H33NO2 — CID 165353092
cis-(3R,10R)-3,11-diethyl-10-hydroxy-azacyclotetradecan-2-one (PubChem CID 165353092) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is cis-(3R,10R)-3,11-diethyl-10-hydroxy-azacyclotetradecan-2-one.
| Compound Name | cis-(3R,10R)-3,11-diethyl-10-hydroxy-azacyclotetradecan-2-one |
|---|---|
| PubChem CID | 165353092 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | cis-(3R,10R)-3,11-diethyl-10-hydroxy-azacyclotetradecan-2-one |
| SMILES | CCC1CCCNC(=O)[C@H](CC)CCCCCC[C@H]1O |
| InChI | InChI=1S/C17H33NO2/c1-3-14-11-9-13-18-17(20)15(4-2)10-7-5-6-8-12-16(14)19/h14-16,19H,3-13H2,1-2H3,(H,18,20)/t14?,15-,16-/m1/s1 |
| InChIKey | YLVXFMVXJOZAMY-ANGDWKNPSA-N |
| XLogP | 3.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |