C7H10O2 — CID 58446340
3,5-dimethylcyclopenta-2,5-diene-1,2-diol (PubChem CID 58446340) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is 3,5-dimethylcyclopenta-2,5-diene-1,2-diol.
| Compound Name | 3,5-dimethylcyclopenta-2,5-diene-1,2-diol |
|---|---|
| PubChem CID | 58446340 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 3,5-dimethylcyclopenta-2,5-diene-1,2-diol |
| SMILES | CC1=C(O)C(O)=C(C)C1 |
| InChI | InChI=1S/C7H10O2/c1-4-3-5(2)7(9)6(4)8/h8-9H,3H2,1-2H3 |
| InChIKey | VPTMFJALGHYXHM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |