C7H12NO+ — CID 20667801
1,4,5-trimethyl-3H-pyrrol-1-ium-2-ol (PubChem CID 20667801) has the molecular formula C7H12NO+ and a molecular weight of 126.18 g/mol. Its IUPAC name is 1,4,5-trimethyl-3H-pyrrol-1-ium-2-ol.
| Compound Name | 1,4,5-trimethyl-3H-pyrrol-1-ium-2-ol |
|---|---|
| PubChem CID | 20667801 |
| Molecular Formula | C7H12NO+ |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 1,4,5-trimethyl-3H-pyrrol-1-ium-2-ol |
| SMILES | CC1=C(C)[N+](C)=C(O)C1 |
| InChI | InChI=1S/C7H11NO/c1-5-4-7(9)8(3)6(5)2/h4H2,1-3H3/p+1 |
| InChIKey | GFROOFPAUSKOTH-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|