About (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol
(6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol (PubChem CID 147503380) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol.
Analyze (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol?
The IUPAC name of (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol (CID 147503380) is (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol is C/C=C1/CC(C)=C(C)C=C1O.
What is the InChIKey of (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol?
The InChIKey is FHVZVVLHHIJKJY-WTKPLQERSA-N. The full InChI is InChI=1S/C10H14O/c1-4-9-5-7(2)8(3)6-10(9)11/h4,6,11H,5H2,1-3H3/b9-4-.
What are the key properties of (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol?
(6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol has a molecular weight of 150.22 g/mol, XLogP of 3.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-ethylidene-3,4-dimethylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 147503380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).