C14H18O2 — CID 10330994
(6Z)-6-(hydroxymethylidene)-2,2,8-trimethyl-3,7-dihydro-1H-azulen-5-one (PubChem CID 10330994) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (6Z)-6-(hydroxymethylidene)-2,2,8-trimethyl-3,7-dihydro-1H-azulen-5-one.
| Compound Name | (6Z)-6-(hydroxymethylidene)-2,2,8-trimethyl-3,7-dihydro-1H-azulen-5-one |
|---|---|
| PubChem CID | 10330994 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (6Z)-6-(hydroxymethylidene)-2,2,8-trimethyl-3,7-dihydro-1H-azulen-5-one |
| SMILES | CC1=C2CC(C)(C)CC2=CC(=O)/C(=C\O)C1 |
| InChI | InChI=1S/C14H18O2/c1-9-4-11(8-15)13(16)5-10-6-14(2,3)7-12(9)10/h5,8,15H,4,6-7H2,1-3H3/b11-8- |
| InChIKey | JYLQALVPUXXRNF-FLIBITNWSA-N |
| XLogP | 3.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|