C8H12O2 — CID 135850289
(3,4-dimethylcyclopenta-1,3-dien-1-yl)methanediol (PubChem CID 135850289) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (3,4-dimethylcyclopenta-1,3-dien-1-yl)methanediol.
| Compound Name | (3,4-dimethylcyclopenta-1,3-dien-1-yl)methanediol |
|---|---|
| PubChem CID | 135850289 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (3,4-dimethylcyclopenta-1,3-dien-1-yl)methanediol |
| SMILES | CC1=C(C)CC(C(O)O)=C1 |
| InChI | InChI=1S/C8H12O2/c1-5-3-7(8(9)10)4-6(5)2/h3,8-10H,4H2,1-2H3 |
| InChIKey | JWGFMTHGJZMYJW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|