C26H40 — CID 144843421
4-[(2R,5S)-5-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-3,4-diethylhexan-2-yl]-1,2-dimethylbenzene (PubChem CID 144843421) has the molecular formula C26H40 and a molecular weight of 352.61 g/mol. Its IUPAC name is 4-[(2R,5S)-5-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-3,4-diethylhexan-2-yl]-1,2-dimethylbenzene.
| Compound Name | 4-[(2R,5S)-5-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-3,4-diethylhexan-2-yl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 144843421 |
| Molecular Formula | C26H40 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | 4-[(2R,5S)-5-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-3,4-diethylhexan-2-yl]-1,2-dimethylbenzene |
| SMILES | CCC(C(CC)[C@@H](C)c1ccc(C)c(C)c1)[C@H](C)C1=CC(C)=C(C)CC1 |
| InChI | InChI=1S/C26H40/c1-9-25(21(7)23-13-11-17(3)19(5)15-23)26(10-2)22(8)24-14-12-18(4)20(6)16-24/h11,13,15-16,21-22,25-26H,9-10,12,14H2,1-8H3/t21-,22+,25?,26?/m0/s1 |
| InChIKey | AYFBHAXVOUUGCS-OBBBYGQCSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |