C8H11NO — CID 22460188
hydroxylamine;2-methylbicyclo[2.2.1]hepta-1,3,5-triene (PubChem CID 22460188) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is hydroxylamine;2-methylbicyclo[2.2.1]hepta-1,3,5-triene.
| Compound Name | hydroxylamine;2-methylbicyclo[2.2.1]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 22460188 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | hydroxylamine;2-methylbicyclo[2.2.1]hepta-1,3,5-triene |
| SMILES | CC1=C2C=CC(=C1)C2.NO |
| InChI | InChI=1S/C8H8.H3NO/c1-6-4-7-2-3-8(6)5-7;1-2/h2-4H,5H2,1H3;2H,1H2 |
| InChIKey | HAFKIMOXKIXDIW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|