C19H16O4 — CID 101474914
5,7-dimethoxytricyclo[9.5.1.03,9]heptadeca-1,3(9),4,7,10,12,15-heptaene-6,14-dione (PubChem CID 101474914) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is 5,7-dimethoxytricyclo[9.5.1.03,9]heptadeca-1,3(9),4,7,10,12,15-heptaene-6,14-dione.
| Compound Name | 5,7-dimethoxytricyclo[9.5.1.03,9]heptadeca-1,3(9),4,7,10,12,15-heptaene-6,14-dione |
|---|---|
| PubChem CID | 101474914 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 5,7-dimethoxytricyclo[9.5.1.03,9]heptadeca-1,3(9),4,7,10,12,15-heptaene-6,14-dione |
| SMILES | COc1cc2c(cc(OC)c1=O)C=C1/C=C\C(=O)/C=C\C(=C2)C1 |
| InChI | InChI=1S/C19H16O4/c1-22-17-10-14-8-12-3-5-16(20)6-4-13(7-12)9-15(14)11-18(23-2)19(17)21/h3-6,8-11H,7H2,1-2H3/b5-3-,6-4- |
| InChIKey | ADFLWCKRFJILTH-GLIMQPGKSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |