C12H16 — CID 163429403
(1E,7E)-2-methylbicyclo[6.2.1]undeca-1,7,9-triene (PubChem CID 163429403) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (1E,7E)-2-methylbicyclo[6.2.1]undeca-1,7,9-triene.
| Compound Name | (1E,7E)-2-methylbicyclo[6.2.1]undeca-1,7,9-triene |
|---|---|
| PubChem CID | 163429403 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (1E,7E)-2-methylbicyclo[6.2.1]undeca-1,7,9-triene |
| SMILES | C/C1=C2\C=C/C(=C/CCCC1)C2 |
| InChI | InChI=1S/C12H16/c1-10-5-3-2-4-6-11-7-8-12(10)9-11/h6-8H,2-5,9H2,1H3/b11-6+,12-10+ |
| InChIKey | APEKKGAQAZCNAR-BFPRWLMKSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |