C24H34 — CID 141211419
1-[1,2-di(cyclopenten-1-yl)-2,3,4-trimethylcyclopent-3-en-1-yl]cyclohexene (PubChem CID 141211419) has the molecular formula C24H34 and a molecular weight of 322.54 g/mol. Its IUPAC name is 1-[1,2-di(cyclopenten-1-yl)-2,3,4-trimethylcyclopent-3-en-1-yl]cyclohexene.
| Compound Name | 1-[1,2-di(cyclopenten-1-yl)-2,3,4-trimethylcyclopent-3-en-1-yl]cyclohexene |
|---|---|
| PubChem CID | 141211419 |
| Molecular Formula | C24H34 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1-[1,2-di(cyclopenten-1-yl)-2,3,4-trimethylcyclopent-3-en-1-yl]cyclohexene |
| SMILES | CC1=C(C)C(C)(C2=CCCC2)C(C2=CCCC2)(C2=CCCCC2)C1 |
| InChI | InChI=1S/C24H34/c1-18-17-24(22-15-9-10-16-22,21-13-5-4-6-14-21)23(3,19(18)2)20-11-7-8-12-20/h11,13,15H,4-10,12,14,16-17H2,1-3H3 |
| InChIKey | FWROQCFNQQCZIP-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|