C14H18O2 — CID 135331838
6-(cyclohexen-1-yl)-6-methylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 135331838) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 6-(cyclohexen-1-yl)-6-methylcyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-(cyclohexen-1-yl)-6-methylcyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 135331838 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 6-(cyclohexen-1-yl)-6-methylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC1(C2=CCCCC2)C=CC=CC1C(=O)O |
| InChI | InChI=1S/C14H18O2/c1-14(11-7-3-2-4-8-11)10-6-5-9-12(14)13(15)16/h5-7,9-10,12H,2-4,8H2,1H3,(H,15,16) |
| InChIKey | FCDODDWLAANVBK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|