C14H20 — CID 163531079
(3Z)-3,12-dimethylbicyclo[7.2.1]dodeca-1(11),3,9-triene (PubChem CID 163531079) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (3Z)-3,12-dimethylbicyclo[7.2.1]dodeca-1(11),3,9-triene.
| Compound Name | (3Z)-3,12-dimethylbicyclo[7.2.1]dodeca-1(11),3,9-triene |
|---|---|
| PubChem CID | 163531079 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (3Z)-3,12-dimethylbicyclo[7.2.1]dodeca-1(11),3,9-triene |
| SMILES | C/C1=C/CCCCC2=CC=C(C1)C2C |
| InChI | InChI=1S/C14H20/c1-11-6-4-3-5-7-13-8-9-14(10-11)12(13)2/h6,8-9,12H,3-5,7,10H2,1-2H3/b11-6- |
| InChIKey | DTATZFDFIJISSY-WDZFZDKYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|