C10H14NO+ — CID 58803416
1,6,7-trimethyl-1,5-dihydropyrrolo[1,2-c][1,3]oxazin-8-ium (PubChem CID 58803416) has the molecular formula C10H14NO+ and a molecular weight of 164.23 g/mol. Its IUPAC name is 1,6,7-trimethyl-1,5-dihydropyrrolo[1,2-c][1,3]oxazin-8-ium.
| Compound Name | 1,6,7-trimethyl-1,5-dihydropyrrolo[1,2-c][1,3]oxazin-8-ium |
|---|---|
| PubChem CID | 58803416 |
| Molecular Formula | C10H14NO+ |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1,6,7-trimethyl-1,5-dihydropyrrolo[1,2-c][1,3]oxazin-8-ium |
| SMILES | CC1=C(C)[N+]2=C(C=COC2C)C1 |
| InChI | InChI=1S/C10H14NO/c1-7-6-10-4-5-12-9(3)11(10)8(7)2/h4-5,9H,6H2,1-3H3/q+1 |
| InChIKey | FGJJZLCVHNGORR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|