C10H12O2 — CID 14859707
(2S)-2-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydropyran-4-one (PubChem CID 14859707) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (2S)-2-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydropyran-4-one.
| Compound Name | (2S)-2-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 14859707 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (2S)-2-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydropyran-4-one |
| SMILES | C/C=C/C=C/[C@@H]1CC(=O)C=CO1 |
| InChI | InChI=1S/C10H12O2/c1-2-3-4-5-10-8-9(11)6-7-12-10/h2-7,10H,8H2,1H3/b3-2+,5-4+/t10-/m1/s1 |
| InChIKey | HBBOKJUBFIOJOD-FQTVTVBISA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|