C22H30O6 — CID 10668123
(2R)-2-[(2R,5S,6S)-5-methyl-6-[(2S,3S,6R)-3-methyl-6-[(2R)-4-oxo-2,3-dihydropyran-2-yl]oxan-2-yl]oxan-2-yl]-2,3-dihydropyran-4-one (PubChem CID 10668123) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2R)-2-[(2R,5S,6S)-5-methyl-6-[(2S,3S,6R)-3-methyl-6-[(2R)-4-oxo-2,3-dihydropyran-2-yl]oxan-2-yl]oxan-2-yl]-2,3-dihydropyran-4-one.
| Compound Name | (2R)-2-[(2R,5S,6S)-5-methyl-6-[(2S,3S,6R)-3-methyl-6-[(2R)-4-oxo-2,3-dihydropyran-2-yl]oxan-2-yl]oxan-2-yl]-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 10668123 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (2R)-2-[(2R,5S,6S)-5-methyl-6-[(2S,3S,6R)-3-methyl-6-[(2R)-4-oxo-2,3-dihydropyran-2-yl]oxan-2-yl]oxan-2-yl]-2,3-dihydropyran-4-one |
| SMILES | C[C@H]1CC[C@H]([C@H]2CC(=O)C=CO2)O[C@@H]1[C@H]1O[C@@H]([C@H]2CC(=O)C=CO2)CC[C@@H]1C |
| InChI | InChI=1S/C22H30O6/c1-13-3-5-17(19-11-15(23)7-9-25-19)27-21(13)22-14(2)4-6-18(28-22)20-12-16(24)8-10-26-20/h7-10,13-14,17-22H,3-6,11-12H2,1-2H3/t13-,14-,17+,18+,19+,20+,21-,22-/m0/s1 |
| InChIKey | ZSRUBRBMPWDMAZ-RZPZPBHASA-N |
| XLogP | 3.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |