C9H11NO3 — CID 11435312
N-[1-(4-oxo-2,3-dihydropyran-2-yl)ethenyl]acetamide (PubChem CID 11435312) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is N-[1-(4-oxo-2,3-dihydropyran-2-yl)ethenyl]acetamide.
| Compound Name | N-[1-(4-oxo-2,3-dihydropyran-2-yl)ethenyl]acetamide |
|---|---|
| PubChem CID | 11435312 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | N-[1-(4-oxo-2,3-dihydropyran-2-yl)ethenyl]acetamide |
| SMILES | C=C(NC(C)=O)C1CC(=O)C=CO1 |
| InChI | InChI=1S/C9H11NO3/c1-6(10-7(2)11)9-5-8(12)3-4-13-9/h3-4,9H,1,5H2,2H3,(H,10,11) |
| InChIKey | XAKJHLQUCRXKNT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |