C8H10O3 — CID 93493214
(2S)-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylic acid (PubChem CID 93493214) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (2S)-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylic acid.
| Compound Name | (2S)-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylic acid |
|---|---|
| PubChem CID | 93493214 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (2S)-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylic acid |
| SMILES | C=C(C)[C@@H]1CC(C(=O)O)=CO1 |
| InChI | InChI=1S/C8H10O3/c1-5(2)7-3-6(4-11-7)8(9)10/h4,7H,1,3H2,2H3,(H,9,10)/t7-/m0/s1 |
| InChIKey | VGSBCUNTFPWCCG-ZETCQYMHSA-N |
| XLogP | 1.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|