C10H14O3 — CID 162466814
3-hydroxy-6-[(1E,3E)-penta-1,3-dienyl]oxan-2-one (PubChem CID 162466814) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-hydroxy-6-[(1E,3E)-penta-1,3-dienyl]oxan-2-one.
| Compound Name | 3-hydroxy-6-[(1E,3E)-penta-1,3-dienyl]oxan-2-one |
|---|---|
| PubChem CID | 162466814 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-hydroxy-6-[(1E,3E)-penta-1,3-dienyl]oxan-2-one |
| SMILES | C/C=C/C=C/C1CCC(O)C(=O)O1 |
| InChI | InChI=1S/C10H14O3/c1-2-3-4-5-8-6-7-9(11)10(12)13-8/h2-5,8-9,11H,6-7H2,1H3/b3-2+,5-4+ |
| InChIKey | ZHDREYCYHKMHDP-MQQKCMAXSA-N |
| XLogP | 1.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|