C11H16O — CID 134866027
2-[(E)-prop-1-enyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran (PubChem CID 134866027) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-[(E)-prop-1-enyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran.
| Compound Name | 2-[(E)-prop-1-enyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran |
|---|---|
| PubChem CID | 134866027 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 2-[(E)-prop-1-enyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran |
| SMILES | C/C=C/C1CCC2=C(CCC2)O1 |
| InChI | InChI=1S/C11H16O/c1-2-4-10-8-7-9-5-3-6-11(9)12-10/h2,4,10H,3,5-8H2,1H3/b4-2+ |
| InChIKey | WMINKIPGSPROSG-DUXPYHPUSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|