C12H16 — CID 142636500
1-[(E)-prop-1-enyl]-2,3,4,5-tetrahydro-1H-indene (PubChem CID 142636500) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-[(E)-prop-1-enyl]-2,3,4,5-tetrahydro-1H-indene.
| Compound Name | 1-[(E)-prop-1-enyl]-2,3,4,5-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 142636500 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-[(E)-prop-1-enyl]-2,3,4,5-tetrahydro-1H-indene |
| SMILES | C/C=C/C1CCC2=C1C=CCC2 |
| InChI | InChI=1S/C12H16/c1-2-5-10-8-9-11-6-3-4-7-12(10)11/h2,4-5,7,10H,3,6,8-9H2,1H3/b5-2+ |
| InChIKey | FRSDPKLIMSCGRL-GORDUTHDSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|