C13H20 — CID 101316618
2-propan-2-yl-1,2,3,4,5,6-hexahydronaphthalene (PubChem CID 101316618) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 2-propan-2-yl-1,2,3,4,5,6-hexahydronaphthalene.
| Compound Name | 2-propan-2-yl-1,2,3,4,5,6-hexahydronaphthalene |
|---|---|
| PubChem CID | 101316618 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 2-propan-2-yl-1,2,3,4,5,6-hexahydronaphthalene |
| SMILES | CC(C)C1CCC2=C(C=CCC2)C1 |
| InChI | InChI=1S/C13H20/c1-10(2)12-8-7-11-5-3-4-6-13(11)9-12/h4,6,10,12H,3,5,7-9H2,1-2H3 |
| InChIKey | PGOWXITVXUFADL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |