C14H20 — CID 57022585
(4aS,10aS)-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene (PubChem CID 57022585) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (4aS,10aS)-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene.
| Compound Name | (4aS,10aS)-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene |
|---|---|
| PubChem CID | 57022585 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (4aS,10aS)-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene |
| SMILES | C1=CC2=C(CC1)CC[C@@H]1CCCC[C@H]21 |
| InChI | InChI=1S/C14H20/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h3,7,12,14H,1-2,4-6,8-10H2/t12-,14-/m0/s1 |
| InChIKey | QMDUYVZGZUHYDA-JSGCOSHPSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |