C14H18Cl2 — CID 57247407
(4aS,10aS)-5,7-dichloro-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene (PubChem CID 57247407) has the molecular formula C14H18Cl2 and a molecular weight of 257.20 g/mol. Its IUPAC name is (4aS,10aS)-5,7-dichloro-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene.
| Compound Name | (4aS,10aS)-5,7-dichloro-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene |
|---|---|
| PubChem CID | 57247407 |
| Molecular Formula | C14H18Cl2 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (4aS,10aS)-5,7-dichloro-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene |
| SMILES | ClC1=CC(Cl)CC2=C1[C@H]1CCCC[C@H]1CC2 |
| InChI | InChI=1S/C14H18Cl2/c15-11-7-10-6-5-9-3-1-2-4-12(9)14(10)13(16)8-11/h8-9,11-12H,1-7H2/t9-,11?,12-/m0/s1 |
| InChIKey | SYDNHIGMYBKLPC-VAGKLZBCSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|