C11H19N — CID 143341086
1,2,3a,4,5,6,7,8,9,9a-decahydrocyclopenta[8]annulen-3-imine (PubChem CID 143341086) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 1,2,3a,4,5,6,7,8,9,9a-decahydrocyclopenta[8]annulen-3-imine.
| Compound Name | 1,2,3a,4,5,6,7,8,9,9a-decahydrocyclopenta[8]annulen-3-imine |
|---|---|
| PubChem CID | 143341086 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1,2,3a,4,5,6,7,8,9,9a-decahydrocyclopenta[8]annulen-3-imine |
| SMILES | [H]/N=C1\CCC2CCCCCCC12 |
| InChI | InChI=1S/C11H19N/c12-11-8-7-9-5-3-1-2-4-6-10(9)11/h9-10,12H,1-8H2/b12-11+ |
| InChIKey | MXNTWEOJAODKPO-VAWYXSNFSA-N |
| XLogP | 3.39 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|