C8H13NS — CID 162411129
3a,4,5,6,7,7a-hexahydro-1-benzothiophen-3-imine (PubChem CID 162411129) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydro-1-benzothiophen-3-imine.
| Compound Name | 3a,4,5,6,7,7a-hexahydro-1-benzothiophen-3-imine |
|---|---|
| PubChem CID | 162411129 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 3a,4,5,6,7,7a-hexahydro-1-benzothiophen-3-imine |
| SMILES | [H]/N=C1\CSC2CCCCC12 |
| InChI | InChI=1S/C8H13NS/c9-7-5-10-8-4-2-1-3-6(7)8/h6,8-9H,1-5H2/b9-7+ |
| InChIKey | JOTNETVLVSRDLG-VQHVLOKHSA-N |
| XLogP | 2.31 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|